3-Fluoro-5-bromotyrosine
3-Fluoro-5-bromotyrosine is a valuable compound used in the biomedical field for drug discovery and research. It is commonly utilized to study the effects of modifications on tyrosine residues within proteins is aiding in the understanding of protein structures and functions. This compound is particularly significant in investigating diseases related to protein malfunction and developing targeted therapies for such conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 369-95-9 |
| Pricing | Inquire |
| Cas | 369-95-9 |
| Molecular Weight | 278.07 |
| Molecular Formula | C9H9BrFNO3 |
| Canonical SMILES | C1=C(C=C(C(=C1F)O)Br)CC(C(=O)O)N |