3-Amino-6-chloro-5-[ethyl(1-methylethyl)amino]-2-pyrazinecarboxylic Acid Methyl Ester
3-Amino-6-chloro-5-[ethyl(1-methylethyl)amino]-2-pyrazinecarboxylic Acid Methyl Ester is an intermediate in the synthesis of 5-(N-Ethyl-N-isopropyl) Amiloride which is a selective Na+/H+ antiporter inhibitor. Selectively enhances the excretion of sodium ions without causing an increase in excretion of potassium ions.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB074946 |
| Pricing | Inquire |
| Cas | 14232-37-2 |
| Molecular Weight | 272.73 |
| Molecular Formula | C11H17ClN4O2 |
| Canonical SMILES | CCN(C1=NC(=C(N=C1Cl)C(=O)OC)N)C(C)C |