Tryptoquivaline D
Tryptoquivaline D is a fungal metabolite originally isolated from Neosartorya siamensis and it has anticancer activity. It induces nuclear chromatin condensation, a marker of apoptosis, in HCT116 colon and HepG2 liver cancer cells when used at a concentration of 150 µM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 60676-56-4 |
| Pricing | Inquire |
| Cas | 60676-56-4 |
| Molecular Weight | 532.54 |
| Molecular Formula | C28H28N4O7 |
| Canonical SMILES | CC1C(=O)N2C(N1O)C3(CC(C(=O)O3)N4C(=O)C5=CC=CC=C5N=C4C(C(C)C)OC(=O)C)C6=CC=CC=C62 |