L-Menthylglucoside
L-Menthylglucoside is an intricately synthesized biomedical compound, esteemed for its inhibitory efficacy in studying diverse dermatological ailments such as xeroderma, dermatitis and plaque psoriasis. This multifaceted substance is endowed with potent antioxidative and anti-inflammatory attributes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 16203-27-3 |
| Pricing | Inquire |
| Cas | 16203-27-3 |
| Molecular Weight | 318.41 |
| Molecular Formula | C16H30O6 |
| Canonical SMILES | CC1CCC(C(C1)OC2C(C(C(C(O2)CO)O)O)O)C(C)C |