Ticagrelor Impurity A
An impurity of Ticagrelor which is a reversible P2Y12 receptor antagonist and is unique in its greater and more rapid and consistent, yet reversible, inhibition of the ADP receptor.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0027-484065 |
| Pricing | 10 mg/unit USD $519 |
| Cas | 1788033-05-5 |
| Molecular Weight | 522.57 |
| Molecular Formula | C23H28F2N6O4S |
| Canonical SMILES | CCCSC1=NC(=C2C(=N1)N(N=N2)C3CC3C4=CC(=C(C=C4)F)F)NC5CC(C(C5O)O)OCCO |