Ticagrelor EP Impurity B
Ticagrelor EP Impurity B is an impurity of Ticagrelor, which is a reversible P2Y12 receptor antagonist used for the prevention of stroke, heart attack and other events in people with acute coronary syndrome, meaning problems with blood supply in the coronary arteries.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0027-484065 |
| Pricing | Inquire |
| Cas | 1788033-05-5 |
| Molecular Weight | 522.57 |
| Molecular Formula | C23H28F2N6O4S |
| Canonical SMILES | CCCSC1=NC(=C2C(=N1)N(N=N2)C3CC3C4=CC(=C(C=C4)F)F)NC5CC(C(C5O)O)OCCO |