4'-C-Azido-3'-deoxy-3'-fluorocytidine
4'-C-Azido-3'-deoxy-3'-fluorocytidine, an esteemed antiviral compound widely employed in the biomedical sector, demonstrates remarkable efficacy against a plethora of viral infections spurred by notorious maladies like HIV and hepatitis B. By intricately hampering the synthesis of viral DNA or RNA, this nucleoside analogue zealously curtails viral replication, furnishing researchers with an invaluable resource in their relentless pursuit of antiviral drug development and unraveling the intricate mechanisms of viral pathogenesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1145869-46-0 |
| Pricing | Inquire |
| Cas | 1145869-46-0 |
| Molecular Weight | 286.22 |
| Molecular Formula | C9H11FN6O4 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)(CO)N=[N+]=[N-])F)O |