Aldgamycin G
It is produced by the strain of Streptomyces lavendulae and Str. avidinii. The anti-gram-positive bacteria activity of G was stronger than that of F, and the anti-Staphylococcus aureus activity was similar to that of xiramycin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00415 |
| Pricing | Inquire |
| Cas | 107745-56-2 |
| Molecular Weight | 740.83 |
| Molecular Formula | C37H56O15 |
| Canonical SMILES | CC1CC(C(=O)C=CC2C(O2)C(C(OC(=O)C=CC(C1OC3C(C4(CC(O3)C)C(OC(=O)O4)C)O)C)C)COC5C(C(C(C(O5)C)O)OC)OC)C |