m-Toluenesulfonyl chloride
m-Toluenesulfonyl Chloride was used as a reagent in the synthesis of sulfone hybrid scaffolds which displayed β-glucuronidase inhibitory potential. Also used in the synthesis of arylmenthols via radical arylation of isopulegol.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1899-93-0 |
| Pricing | Inquire |
| Cas | 1899-93-0 |
| Molecular Weight | 190.65 |
| Molecular Formula | C7H7ClO2S |
| Canonical SMILES | CC1=CC(=CC=C1)S(=O)(=O)Cl |