4-Methylphenyl b-D-thiogalactopyranoside
4-Methylphenyl β-D-thiogalactopyranoside is a synthetic compound acting as a substrate for the enzyme β-D-galactosidase and can be used to induce gene expression in studies related to the lac operon. This compound is particularly useful in molecular biology research for investigating the regulation of gene expression and analyzing protein interactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 28244-98-6 |
| Pricing | Inquire |
| Cas | 28244-98-6 |
| Molecular Weight | 286.35 |
| Molecular Formula | C13H18O5S |
| Canonical SMILES | CC1=CC=C(C=C1)SC2C(C(C(C(O2)CO)O)O)O |