1-Butyl-1-Methylpiperidinium Bis(Trifluoromethylsulfonyl)Imide
1-Butyl-1-methylpiperidinium bis(trifluoromethylsulfonyl)imide is an ionic liquid that can be used as an electrolyte in ionic liquid dual ion battery and dual-graphite battery. It can also be used as a model ionic liquid in the study of ionic effect on the desulfurization of fuels.
| Supplier | BOC Sciences |
|---|---|
| Product # | 623580-02-9 |
| Pricing | Inquire |
| Cas | 623580-02-9 |
| Molecular Weight | 436.44 |
| Molecular Formula | C10H22N.C2F6NO4S2 |
| Canonical SMILES | CCCC[N+]1(CCCCC1)C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |