Bacillosporin C
Bacillosporin C is an oxaphenalenone dimer found in T. bacillosporus. Bacillosporin C is an anhydride formed from the lactone bacillosporin D in the mangrove endophytic fungus SBE-14. Similar oxaphenalenone dimers have antibiotic activity and can inhibit acetylcholinesterase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76706-63-3 |
| Pricing | Inquire |
| Cas | 76706-63-3 |
| Molecular Weight | 490.41 |
| Molecular Formula | C26H18O10 |
| Canonical SMILES | CC1=CC(=C2C3=C1C(=O)CC4(C3(COC2=O)C5=C(C6=C7C(=C5O4)C(=CC(=C7C(=O)OC6)O)C)O)O)O |