9-Benzylidenefluorene
9-Benzylidenefluorene (CAS# 1836-87-9) is a by-product in the synthesis of Benz[e]acephenanthrylene (B209865). Benz[e]acephenanthrylene is a polycyclic aromatic hydrocarbon that was detected in significant levels in airborne pollutants, auto exhaust and tobacco and marijuana smoke.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1836-87-9 |
| Pricing | Inquire |
| Cas | 1836-87-9 |
| Molecular Weight | 254.33 |
| Molecular Formula | C20H14 |
| Canonical SMILES | C1=CC=C(C=C1)C=C2C3=CC=CC=C3C4=CC=CC=C42 |