1-(3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-β-D-arabinofuranosyl)-5-bromo-uracil
1-(3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-β-D-arabinofuranosyl)-5-bromo-uracil is a specialized synthetic compound pivotal in the development of anti-viral drugs. It's used primarily in research to study its inhibitory effects on the replication of certain DNA viruses, contributing to potential treatments for viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 213136-12-0 |
| Pricing | Inquire |
| Cas | 213136-12-0 |
| Molecular Weight | 533.30 |
| Molecular Formula | C23H18BrFN2O7 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=C(C(=O)NC3=O)Br)F)OC(=O)C4=CC=CC=C4 |