DMT-dG(iBu)-5'-CE Reverse Phosphoramidite
DMT-dG(iBu)-5'-CE Reverse Phosphoramidite is a compound used in the synthesis of oligonucleotides, specifically designed for automated DNA synthesis systems. It is essential for the efficient and precise assembly of custom DNA sequences in laboratory settings, ensuring that each nucleotide is added correctly and in the desired sequence during automated oligonucleotide synthesis processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 140839-24-3 |
| Pricing | Inquire |
| Cas | 140839-24-3 |
| Molecular Weight | 839.92 |
| Molecular Formula | C44H54N7O8P |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3CC(C(O3)COP(N(C(C)C)C(C)C)OCCC#N)OC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |