1-(4-((3-Chloro-4-fluorocyclohexyl)amino)-7-methoxyquinazolin-6-yl)-5-hydroxypyrrolidin-2-one
One of the impurities of Dacomitinib. Dacomitinib, aslo known as PF-299 and PF-00299804 or PF299804, is an orally bioavailable, highly selective, second-generation small-molecule inhibitor of the pan-epidermal growth factor receptor (EGFR) family of tyrosine kinases (ErbB family) with potential antineoplastic activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2190490-31-2 |
| Pricing | Inquire |
| Cas | 2190490-31-2 |
| Molecular Weight | 402.81 |
| Molecular Formula | C19H16ClFN4O3 |
| Canonical SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)N4C(CCC4=O)O |