SHP099 HCl
SHP099 is a potent, selective, orally bioavailable, and efficacious SHP2 inhibitor (IC50 value 0.071 μM) that stabilizes SHP2 in an auto-inhibited conformation. SHP099 suppresses signaling through the Ras-ERK pathway and blocks the proliferation of receptor tyrosine kinase-driven human cancer cells in vitro and in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2693-007852 |
| Pricing | Inquire |
| Cas | 1801747-11-4 |
| Molecular Weight | 388.72 |
| Molecular Formula | C16H20Cl3N5 |
| Canonical SMILES | NC1=NC(N2CCC(C)(N)CC2)=CN=C1C3=CC=CC(Cl)=C3Cl.[H]Cl |