(5-Hydroxy rosiglitazone)-b-D-glucuronide
(5-Hydroxy rosiglitazone)-b-D-glucuronide is a biochemical compound used as a metabolite marker in diabetes research. Specifically, it is associated with the study of type 2 diabetes mellitus as a breakdown product of rosiglitazone, an antidiabetic medication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 288853-59-8 |
| Pricing | Inquire |
| Cas | 288853-59-8 |
| Molecular Weight | 549.55 |
| Molecular Formula | C24H27N3O10S |
| Canonical SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=NC=C(C=C3)OC4C(C(C(C(O4)C(=O)O)O)O)O |