1, 3- Benzodioxol- 5- yl- 1- pyrrolidinyl-methanone
1, 3- Benzodioxol- 5- yl- 1- pyrrolidinyl-methanone is an intermediate for the synthesis of Pancratistatin (P173600), which acts as an anti-cancer compound that initiates cell-death in cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB062203 |
| Pricing | Inquire |
| Cas | 64654-10-0 |
| Molecular Weight | 219.24 |
| Molecular Formula | C12H13NO3 |
| Canonical SMILES | C1CCN(C1)C(=O)C2=CC3=C(C=C2)OCO3 |