Venturicidin B
The macrolide antibiotic isolated from a streptomyces sp. It is a potent inhibitor of mitochondrial ATP synthase complex acting on the F0 membrane sector. It is originally isolated as an antifungal agent.
Supplier | BOC Sciences |
---|---|
Product # | 33538-72-6 |
Pricing | Inquire |
Cas | 33538-72-6 |
Molecular Weight | 706.94 |
Molecular Formula | C40H66O10 |
Canonical SMILES | CCC(=O)C(C)C(C(C)CC(C)C1C(CC(C=CC(CCCC=C(C2C(=CCC(O2)(CC(=O)O1)O)C)C)OC3CC(C(C(O3)C)O)O)C)C)O |