2-Deoxy-3,4,6-tri-O-acetyl-D-glucose
2-Deoxy-3,4,6-tri-O-acetyl-D-glucose, a pivotal compound extensively employed in biomedical studies and pharmaceutical advancements, showcases immense importance. This acetylated molecular structure acts as a vital precursor in synthesizing diverse therapeutic agents, rendering it instrumental in combatting ailments like cancer, viral infections, and diabetes. Moreover, its commercial availability expedites the accessibility for researchers and scientists, propelling the exploration of its promising therapeutic properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 69503-94-2 |
| Pricing | Inquire |
| Cas | 69503-94-2 |
| Molecular Weight | 290.27 |
| Molecular Formula | C12H18O8 |
| Canonical SMILES | CC(=O)OCC1C(C(CC(O1)O)OC(=O)C)OC(=O)C |