Isoxazole-4-boronic Acid Pinacol Ester
Isoxazole-4-boronic Acid Pinacol Ester (CAS# 928664-98-6) is a reagent used in the preparation of potent and selective in vivo probe (GNE-272) for bromodomains of CBP/EP300 involved in cancer and immune system regulation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB040687 |
| Pricing | Inquire |
| Cas | 928664-98-6 |
| Molecular Weight | 195.02 |
| Molecular Formula | C9H14NO3B |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CON=C2 |