3'-O-Methyl-5'-guanylic acid
3’-O-Methyl-5’-guanylic acid is a pivotal molecule extensively employed in the realm of compound is assuming an eminent position in the research and development of sundry pharmaceutical agents and investigations concerning RNA and DNA architectures.
| Supplier | BOC Sciences |
|---|---|
| Product # | 400806-41-9 |
| Pricing | Inquire |
| Cas | 400806-41-9 |
| Molecular Weight | 377.25 |
| Molecular Formula | C11H16N5O8P |
| Canonical SMILES | COC1C(OC(C1O)N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)O |