Tyrocidine B hydrochloride
Tyrocidine B is a peptide antibiotic originally isolated from Bac. brevis. It is resistant to gram-positive bacteria and protozoa as well as to a lesser degree to gram-negative bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02732 |
| Pricing | Inquire |
| Cas | 27805-48-7 |
| Molecular Weight | 1345.97 |
| Molecular Formula | C68H89ClN14O13 |
| Canonical SMILES | CC(C)CC1C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCN)C(C)C)CC3=CC=C(C=C3)O)CCC(=O)N)CC(=O)N)CC4=CC=CC=C4)CC5=CNC6=CC=CC=C65)CC7=CC=CC=C7.Cl |