Spirohexenolide A
Spirohexenolide A is a metabolite produced by the strain of S. platensis. It inhibits growth in the NCI-60 cancer cell line panel (GI50s = 0.1-17 μM) with the RPMI-8226 multiple myeloma, HOP-92 lung, and SW620 colon cancer cell lines being most sensitive (GI50s = 254, 191, and 565 nM, respectively). Spirohexenolide A also binds to human macrophage migration inhibition factor (MIF; Kd = 35.9 μM) and inhibits MIF cellular uptake and lysosomal localization in HCT116 cells.
Supplier | BOC Sciences |
---|---|
Product # | 1193347-22-6 |
Pricing | Inquire |
Cas | 1193347-22-6 |
Molecular Weight | 408.49 |
Molecular Formula | C25H28O5 |
Canonical SMILES | CC1CC23C(=O)C(=C4C=CC(=CC(CC=CC(=CC2(C=C1C)C)C)O)CO4)C(=O)O3 |