DNP-PEG4-OH
DNP-PEG4-OH is a PEG linker containing a dinitrophenyl and a hydroxyl group. DNP is involved in biological applications such as participating in ion transport across membranes. The hydroxyl group can react to further derivatize the compound. The hydrophilic PEG linker increases the water solubility of the compound in aqueous environments.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-501181 |
| Pricing | Inquire |
| Cas | 1807520-99-5 |
| Molecular Weight | 359.34 |
| Molecular Formula | C14H21N3O8 |
| Canonical SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCOCCOCCOCCO |