3,5-Bis(trifluoromethyl)benzyl bromide
3,5-Bis(trifluoromethyl)benzyl bromide (CAS# 32247-96-4) is used as a reagent in the synthesis of [(chlorophenyl)benzylamino]propanamides as cholesteryl ester transfer protein (CETP) inhibitors. Also used as a reagent in the synthesis of substituted dihydropyridopyrazinedione derivatives as γ-secretase modulators in the treatment of Alzheimer's disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 32247-96-4 |
| Pricing | Inquire |
| Cas | 32247-96-4 |
| Molecular Weight | 307.03 |
| Molecular Formula | C9H5BrF6 |
| Canonical SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CBr |