(E,E)-6-α-Ionylidene-4-methylpyran-2-one
(E,E)-6-α-Ionylidene-4-methylpyran-2-one is a renowned chemical compound in the biomedical industry, aiding in effectively impeding the proliferation of specific malignant cells, thereby paving the way for its application as an anti-cancer medication. Furthermore, its multifaceted nature unveils outstanding anti-inflammatory attributes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 87424-83-7 |
| Pricing | Inquire |
| Cas | 87424-83-7 |
| Molecular Weight | 298.42 |
| Molecular Formula | C20H26O2 |
| Canonical SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC2=CC(=CC(=O)O2)C)C |