Methyl 5-Chloro-1-oxo-2,3-dihydro-1H-indene-2-carboxylate
Methyl 5-Chloro-1-oxo-2,3-dihydro-1H-indene-2-carboxylate is an intermediate in the synthesis of IN-KG 433 (I627995) which is an impurity of Indoxacarb (I654000), an oxadiazine pesticide that acts against lepidopteran larvae and is the active ingredient in a number of household insecticides including cockroach baits.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB059076 |
| Pricing | Inquire |
| Cas | 65738-56-9 |
| Molecular Weight | 224.64 |
| Molecular Formula | C11H9ClO3 |
| Canonical SMILES | COC(=O)C1CC2=C(C1=O)C=CC(=C2)Cl |