FD-IN-1
FD-IN-1 is an orally bioavailable and selective inhibitor of factor D (FD) with an IC50 of 12 nM. It also inhibits factor XIa (FXIa) and Tryptase β2 with IC50s of 7.7 and 6.5 µM, respectively. Complement FD is a highly specific S1 serine protease that plays a central role in the alternative complement pathway of the innate immune system.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1646682-14-5 |
| Pricing | Inquire |
| Cas | 1646682-14-5 |
| Molecular Weight | 377.43 |
| Molecular Formula | C23H23NO4 |
| Canonical SMILES | C1=CC=C(C(=C1)CC(=O)O)OCC2=CC(=CC=C2)C3=CC(=CC=C3)C(CO)N |