3β-6β-Dihydroxy olean-12-en-28-oic acid
3β-6β-Dihydroxy olean-12-en-28-oic acid is an exceedingly potent and multifaceted compound encountered in diverse plant species aiding in studying inflammation. This exceptional product showcases an extraordinary ability to thwart inflammation by skillfully impeding the activities of specified enzymes and intricate signaling cascades that are crucial in exacerbating inflammatory responses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 559-64-8 |
| Pricing | Inquire |
| Cas | 559-64-8 |
| Molecular Weight | 472.70 |
| Molecular Formula | C30H48O4 |
| Canonical SMILES | CC1(CCC2(CCC3(C(=CCC4C3(CC(C5C4(CCC(C5(C)C)O)C)O)C)C2C1)C)C(=O)O)C |