2'-O-Acetyl-3'-azido-5'-O-benzoyl-3'-deoxyuridine
2'-O-Acetyl-3'-azido-5'-O-benzoyl-3'-deoxyuridine is a highly efficacious antiviral compound extensively employed in the field of compound, manifesting its effectiveness by impeding the replication of viral DNA. The active component specifically targets viral thymidine kinase and DNA polymerase, exquisitely obstructing viral propagation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 917239-19-1 |
| Pricing | Inquire |
| Cas | 917239-19-1 |
| Molecular Weight | 415.36 |
| Molecular Formula | C18H17N5O7 |
| Canonical SMILES | CC(=O)OC1C(C(OC1N2C=CC(=O)NC2=O)COC(=O)C3=CC=CC=C3)N=[N+]=[N-] |