2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-xylopyranoside
2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-xylopyranoside is a biochemical used in medicinal research, especially for the development and testing of antiviral drugs. It serves as a substrate in enzymatic reactions related to the metabolism and interaction of fluoro-substituted carbohydrates.
| Supplier | BOC Sciences |
|---|---|
| Product # | 172218-63-2 |
| Pricing | Inquire |
| Cas | 172218-63-2 |
| Molecular Weight | 318.21 |
| Molecular Formula | C11H11FN2O8 |
| Canonical SMILES | C1C(C(C(C(O1)OC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-])F)O)O |