2,6-Diamino-9-(2'-O-methyl-b-D-ribofuranosyl)purine
2,6-Diamino-9-(2'-O-methyl-b-D-ribofuranosyl)purine, commonly known as DAP, is an exceptionally significant compound in the realm of biomedicine. Its multifaceted nature renders it invaluable in addressing a plethora of ailments, encompassing viral infections and select cancer variations. Functioning as a formidable antiviral and antineoplastic entity, it skillfully disrupts diverse cellular pathways, impeding DNA synthesis and replication. As a consequence of its distinctive chemical makeup, this compound exhibits precision in its target recognition, thereby establishing itself as an indisputable asset in the domain of biomedical exploration and pharmaceutical advancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 847648-50-4 |
| Pricing | Inquire |
| Cas | 847648-50-4 |
| Molecular Weight | 296.29 |
| Molecular Formula | C11H16N6O4 |
| Canonical SMILES | COC1C(C(OC1N2C=NC3=C(N=C(N=C32)N)N)CO)O |