6-Maleimidocaproic acid sulfo-NHS
6-Maleimidocaproic acid sulfo-NHS is a small molecule reagent used in the biomedical industry. It is commonly used to modify biomolecules, such as proteins and antibodies, for site-specific conjugation. This compound enables the efficient and stable attachment of drugs, tags, or targeting moieties to these biomolecules, thereby facilitating the development of innovative treatments for a variety of diseases, including cancer and autoimmune diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-00505 |
| Pricing | Inquire |
| Cas | 103848-61-9 |
| Molecular Weight | 388.35 |
| Molecular Formula | C14H16N2O9S |
| Canonical SMILES | C1C(C(=O)N(C1=O)OC(=O)CCCCCN2C(=O)C=CC2=O)S(=O)(=O)O |