5-Acetylsalicylamide
5-Acetylsalicylamide (CAS# 40187-51-7) is used as a reagent in the synthesis of Phosphotyrosine(P365000) peptidomimetic prodrugs, compounds that have similar structure to small protein-like chains in order to mimic peptide activities. 5-Acetylsalicylamide is also used as a reagent to prepare 4-aminopiperidine ureas, compounds that act as human β3 adrenergic receptor agonists.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB024356 |
| Pricing | Inquire |
| Cas | 40187-51-7 |
| Molecular Weight | 179.17 |
| Molecular Formula | C9H9NO3 |
| Canonical SMILES | CC(=O)C1=CC(=C(C=C1)O)C(=O)N |