3'-Deoxy-3'-fluoro-5'-O-toluoylcytidine
3'-Deoxy-3'-fluoro-5'-O-toluoylcytidine, a groundbreaking compound, exhibits immense promise in the realms of biomedicine. Its profound impact on the treatment of various maladies and medical scenarios has captivated the interest of researchers. Comprehensive elucidation of its inherent properties and diverse applications can be obtained from the specified online resources.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2072145-50-5 |
| Pricing | Inquire |
| Cas | 2072145-50-5 |
| Molecular Weight | 363.34 |
| Molecular Formula | C17H18FN3O5 |
| Canonical SMILES | CC1=CC=CC=C1C(=O)C(C2C(C(C(O2)N3C=CC(=NC3=O)N)O)F)O |