PD 173212
PD 173212 is a potent N-type voltage-gated calcium channel blocker (IC50 = 36 nM), with selectivity over K+, Na+ and L-type Ca2+ channels. Selective N-type voltage sensitive calcium channel (VSCC) blockers have shown efficacy in several animal models of stroke and pain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 217171-01-2 |
| Pricing | Inquire |
| Cas | 217171-01-2 |
| Molecular Weight | 599.85 |
| Molecular Formula | C38H53N3O3 |
| Canonical SMILES | CC(C)CC(C(=O)NC(CC1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)NC(C)(C)C)N(C)CC3=CC=C(C=C3)C(C)(C)C |