USP7-IN-1
USP7-IN-1 is a novel selective and reversible inhibitor of USP7 with IC50 of 33 uM; less or no inhibition on USP5, USP8, Uch-L1, Uch-L3 and Caspase(IC50>200 uM); HCT116 cell viability GI50 is 67 uM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1381291-36-6 |
| Pricing | Inquire |
| Cas | 1381291-36-6 |
| Molecular Weight | 425.91 |
| Molecular Formula | C23H24ClN3O3 |
| Canonical SMILES | C1CN(CCC1(CN2C=NC3=C(C2=O)C=CC(=C3)Cl)O)C(=O)CCC4=CC=CC=C4 |