5-Bromo-6-chloro-3-indolyl acetate
5-Bromo-6-chloro-3-indolyl acetate, a chemical compound widely utilized in the biomedical sector, assumes a paramount role in enzymatic assays within academic and scientific circles. Its primary function involves the detection and quantification of β-galactosidase, an indispensable enzyme intrinsic to numerous pharmaceuticals, malignancies, pathogens, and hereditary abnormalities. In research and diagnostic domains, this highly efficacious substrate guarantees dependable and precise outcomes, thereby exemplifying its quintessential significance.
Supplier | BOC Sciences |
---|---|
Product # | 102185-48-8 |
Pricing | Inquire |
Cas | 102185-48-8 |
Molecular Weight | 288.52 |
Molecular Formula | C10H7BrClNO2 |
Canonical SMILES | CC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl |