3-(3,6-Dichloro-9H-carbazol-9-yl)propanoic acid
3-(3,6-Dichloro-9H-carbazol-9-yl)propanoic acid, an ASIC3 inhibitor, effectively blocks ASIC3-mediated pain and inflammation and has been shown to have potential applications in the treatment of other conditions such as stroke, epilepsy, and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 300816-42-6 |
| Pricing | Inquire |
| Cas | 300816-42-6 |
| Molecular Weight | 308.16 |
| Molecular Formula | C15H11Cl2NO2 |
| Canonical SMILES | C1=CC2=C(C=C1Cl)C3=C(N2CCC(=O)O)C=CC(=C3)Cl |