Norfentanyl-[d5] Oxalate
Norfentanyl-[d5] Oxalate, is the labelled analogue of Norfentanyl, which is a metabolite of Fentanyl. Fentanyl is an opioid used as a pain medication and together with other medications for anesthesia.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003579 |
| Pricing | Inquire |
| Cas | 1435933-84-8 |
| Molecular Weight | 327.39 |
| Molecular Formula | C16H17D5N2O5 |
| Canonical SMILES | CCC(=O)N(C1CCNCC1)C2=CC=CC=C2.C(=O)(C(=O)O)O |