Ergosta-4,6,8(14),22-tetraen-3-one
Ergosta-4,6,8(14),22-tetraen-3-one, isolated from the fruit body of Polyporus umbellatus, prevents early renal injury in aristolochic acid-induced nephropathy rats. Besides, Ergosta-4,6,8(14),22-tetraen-3-one induces G2/M cell cycle arrest and apoptosis in human hepatocellular carcinoma HepG2 cells. It would be useful for the further utilization of many medicinal fungi in cancer treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 19254-69-4 |
| Pricing | Inquire |
| Cas | 19254-69-4 |
| Molecular Weight | 392.6 |
| Molecular Formula | C28H40O |
| Canonical SMILES | CC(C)C(C)C=CC(C)C1CCC2=C3C=CC4=CC(=O)CCC4(C3CCC12C)C |