5-Indolylboronic Acid
Reactant involved in the synthesis of biologically active molecules including: Indole inhibitors of MMP-13 for arthritic disease treatment; Substituted pyrimidines acting as tubulin polymerization inhibitorsReactant involved in Suzuki coupling reactions for synthesis of ; Aryl- hetarylfurocoumarins; Aryl-substituted oxabenzindoles and methanobenzindoles. Reactant involved in: Oxidative cross-coupling with mercaptoacetylenes; Trifluoromethylation. Substrate used in a rhodium-catalyzed 1,4-addition to unprotected maleimides.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB009728 |
| Pricing | Inquire |
| Cas | 144104-59-6 |
| Molecular Weight | 160.97 |
| Molecular Formula | C8H8NO2B |
| Canonical SMILES | B(C1=CC2=C(C=C1)NC=C2)(O)O |