M-TriDAP
M-TriDAP is a peptidoglycan (PGN) degradation product mainly found in Gram-negative bacteria. M-TriDAP is recognized by intracellular sensors NOD1 (CARD4) and, to a lesser extent, NOD2 (CARD15). Recognition of M-TriDAP by NOD1/NOD2 induces a signaling cascade of serine/threonine RIP2 (RICK, CARDIAK) kinase that interacts with IKK, leading to the activation of NF-κB and the production of inflammatory cytokines such as TNF-α and IL-6
| Supplier | BOC Sciences |
|---|---|
| Product # | 60230-21-9 |
| Pricing | Inquire |
| Cas | 60230-21-9 |
| Molecular Weight | 665.64 |
| Molecular Formula | C26H43N5O15 |
| Canonical SMILES | O=CC(NC(=O)C)C(OC(C(=O)NC(C(=O)NC(C(=O)O)CCC(=O)NC(C(=O)O)CCCC(N)C(=O)O)C)C)C(O)C(O)CO |