β-Amino-3-methoxy-4-(phenylmethoxy)benzeneethanol
β-Amino-3-methoxy-4-(phenylmethoxy)benzeneethanol is an impurity formed in the synthesis of metabolites of Epinephrine, which is a hormone and medication used to treat a number of conditions including allergic reaction anaphylaxis, cardiac arrest, and superficial bleeding.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1226258-10-1 |
| Pricing | Inquire |
| Cas | 1226258-10-1 |
| Molecular Weight | 273.33 |
| Molecular Formula | C16H19NO3 |
| Canonical SMILES | COC1=C(C=CC(=C1)C(CO)N)OCC2=CC=CC=C2 |