DMTr-2'-O-TBDMS-5-I-rU-3'-CE-Phosphoramidite
DMTr-2'-O-TBDMS-5-I-rU-3'-CE-Phosphoramidite is a specialized reagent for oligonucleotide synthesis. It consists of a 2'-O-tert-butyldimethylsilyl (TBDMS) modification at the ribose sugar, and a 5-I (5-iodouridine) modification at the uridine base, along with a controlled-efficiency (CE) phosphoramidite backbone at the 3'-end. This modification pattern enhances stability and functionality, making it suitable for various molecular biology applications, including gene expression studies and therapeutic RNA-based treatments.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00526 |
| Pricing | Inquire |
| Cas | 1645262-08-3 |
| Molecular Weight | 986.96 |
| Molecular Formula | C45H60N4O9PISi |
| Canonical SMILES | N#CCCOP(OC1C(OC(N2C=C(I)C(=O)NC2=O)C1O[Si](C)(C)C(C)(C)C)COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)N(C(C)C)C(C)C |