Allyl 3-O-benzyl-2-O-chloroacetyl-a-L-rhamnopyranoside
Allyl 3-O-benzyl-2-O-chloroacetyl-α-L-rhamnopyranoside, a highly esteemed compound within the biomedical field, showcases immense potential in tackling diverse ailments, notably cancer and inflammation. Its pharmacological activities portray promising prospects, rendering it an eminent contender for pharmaceutical advancements.
| Supplier | BOC Sciences |
|---|---|
| Product # | 943307-50-4 |
| Pricing | Inquire |
| Cas | 943307-50-4 |
| Molecular Weight | 370.83 |
| Molecular Formula | C18H23ClO6 |
| Canonical SMILES | CC1C(C(C(C(O1)OCC=C)OC(=O)CCl)OCC2=CC=CC=C2)O |