N4-Acetyl-2'-deoxy-5'-O-DMT-2'-fluorocytidine
N4-Acetyl-2'-deoxy-5'-O-DMT-2'-fluorocytidine, a biomedical product that is extensively studied for the treatment of various cancer types, boasts selective targeting properties allowing it to act as a candidate for cancer therapy. This antiviral and antitumor drug functions by inhibiting DNA replication, contributing to its efficacy in treating cancer. Breast cancer, lung cancer, and leukemia are just some of the many debilitating conditions that this therapy has impressive potential against.
| Supplier | BOC Sciences |
|---|---|
| Product # | 159414-98-9 |
| Pricing | Inquire |
| Cas | 159414-98-9 |
| Molecular Weight | 589.61 |
| Molecular Formula | C32H32FN3O7 |
| Canonical SMILES | CC(=O)NC1=NC(=O)N(C=C1)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O)F |