N4-Benzoyl-3'-O-methylcytidine
N4-Benzoyl-3'-O-methylcytidine is an illustrious biomedical compound, emerging as a formidable tool in studying virulent RNA viruses. In the pursuit of curbing the insidious viral replication, this compound adeptly disrupts the delicate orchestration of viral RNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 85079-03-4 |
| Pricing | Inquire |
| Cas | 85079-03-4 |
| Molecular Weight | 361.35 |
| Molecular Formula | C17H19N3O6 |
| Canonical SMILES | COC1C(OC(C1O)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)CO |